2,3,8,9,14,15-hexa(4-formylphenyl)diquinoxalino[2,3-a:2′,3′-c]phenazine CAS#: 2307218-00-2; ChemWhat Code: 1491273
Login
| Produktname | 2,3,8,9,14,15-hexa(4-formylphenyl)diquinoxalino[2,3-a:2′,3′-c]phenazine |
| IUPAC-Name | 4-[7,16,17,26,27-pentakis(4-formylphenyl)-3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4(9),5,7,10,12,14(19),15,17,20,22,24(29),25,27-pentadecaen-6-yl]benzaldehyde |
| Molekulare Struktur | ![Struktur von 2,3,8,9,14,15-Hexa(4-formylphenyl)diquinoxalino[2,3-a2′,3′-c]phenazin CAS 2307218-00-2](https://www.chemwhat.com/wp-content/uploads/2025/07/Structure-of-23891415-hexa4-formylphenyldiquinoxalino23-a2′3′-cphenazine-CAS-2307218-00-2.png) |
| CAS Registry Number | 2307218-00-2 |
| Synonyme | 3-Pyridinamin;3-Pyridinamine;3-Pyridinamine;pyridin-3-amine;T6NJ CZ;3- Aminopyridine;3-Amino-pyridine;3-p2307218-00-2 4,4′,4”,4”’,4””,4””’-(Diquinoxalino[2,3-a:2′,3′-c]phenazine-2,3,8,9,14,15-hexayl)hexabenzaldehyde 2,3,8,9,14,15-Hexa(4-formylphenyl)diquinoxalino[2,3-a:2′,3′-c]phenazine CS-0170369 4-[7,16,17,26,27-pentakis(4-formylphenyl)-3,10,13,20,23,30-hexaazaheptacyclo[20.8.0.0?,??.0?,?.0??,??.0??,??.0??,??]triaconta-1(30),2,4,6,8,10,12,14,16,18,20,22,24,26,28-pentadecaen-6-yl]benzaldehyde |
| Summenformel | C66H36N6O6 |
| Molekulargewicht | 1009 |
| InChI | InChI=1S/C66H36N6O6/c73-31-37-1-13-43(14-2-37)49-25-55-56(26-50(49)44-15-3-38(32-74)4-16-44)68-62-61(67-55)63-65(71-58-28-52(46-19-7-40(34-76)8-20-46)51(27-57(58)69-63)45-17-5-39(33-75)6-18-45)66-64(62)70-59-29-53(47-21-9-41(35-77)10-22-47)54(30-60(59)72-66)48-23-11-42(36-78)12-24-48/h1-36H |
| InChI Schlüssel | RSRGRQWCLRRNSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC3=C(C=C2C4=CC=C(C=C4)C=O)N=C5C(=N3)C6=NC7=C(C=C(C(=C7)C8=CC=C(C=C8)C=O)C9=CC=C(C=C9)C=O)N=C6C1=NC2=C(C=C(C(=C2)C2=CC=C(C=C2)C=O)C2=CC=C(C=C2)C=O)N=C51 |
Physische Daten
Keine Daten verfügbar
Spectra
| Beschreibung (NMR-Spektroskopie) | Kern (NMR-Spektroskopie) | Lösungsmittel (NMR-Spektroskopie) | Temperatur (NMR-Spektroskopie), ° C | Frequenz (NMR-Spektroskopie), MHz |
| Chemische Verschiebungen | 1H | Dichlormethan-d2 | 25 | 300 |
| Chemische Verschiebungen, Spektrum | 1H | Chloroform-d1 | 20 | 300 |
| COSY (Korrelationsspektroskopie), Spektrum | 1H, 1H | Chloroform-d1 | 20 | 126 |
| NOESY (Nuclear Overhauser Enhanced Spectroscopy), Spektrum | 1H, 1H | Chloroform-d1 | 20 | 126 |
| HSQC (Heteronukleare Einzelquantenkohärenz), Spektrum | 1H, 13C | Chloroform-d1 | 20 | 126 |
| Chemische Verschiebungen, Spektrum | 13C | Chloroform-d1 | 20 | 126 |
| 2,3,8,9,14,15-hexa(4-formylphenyl)diquinoxalino[2,3-a:2′,3′-c]phenazine CAS#: 2307218-00-2 NMR |   |
| Beschreibung (UV / VIS-Spektroskopie) | Lösungsmittel (UV / VIS-Spektroskopie) |
| Spektrum | Isopropylalkohol |
Syntheseweg (ROS)
![Syntheseweg (ROS) von 2,3,8,9,14,15-Hexa(4-formylphenyl)diquinoxalino[2,3-a2′,3′-c]phenazin CAS 2307218-00-2](https://www.chemwhat.com/wp-content/uploads/2023/10/Route-of-Synthesis-ROS-of-23891415-hexa4-formylphenyldiquinoxalino23-a2′3′-cphenazine-CAS-2307218-00-2.png)
| Bedingungen | Ausbeute |
| With tetrakis-(triphenylphosphine)-palladium; potassium carbonate In water monomer; N,N-dimethyl-formamide at 90℃; for 72h; Suzuki Coupling; Inert atmosphere; | 80% |
| With tetrakis-(triphenylphosphine)-palladium; potassium carbonate In water monomer; N,N-dimethyl-formamide at 100℃; for 72h; Schlenk technique; Inert atmosphere; | 77% |
Sicherheit und Gefahren
Keine Daten verfügbar
Andere Daten
| Drogenähnlichkeit | |
| Lipinski-Regelkomponente | |
| Molekulargewicht | 1009.05 |
| logP | 12.99 |
| HBA | 12 |
| HBD | 0 |
| Übereinstimmende Lipinski-Regeln | 1 |
| Veber Regelkomponente | |
| Polare Oberfläche (PSA) | 179.76 |
| Drehbare Bindung (RotB) | 12 |
| Übereinstimmende Veber-Regeln | 0 |
| Muster verwenden |
| 2,3,8,9,14,15-hexa(4-formylphenyl)diquinoxalino[2,3-a:2′,3′-c]phenazine CAS#: 2307218-00-2 is usually used as a OLED material. |
Reagenz kaufen | |
| Kein Reagenzienlieferant? | Schnellanfrage senden an ChemWhat |
| Möchten Sie hier als Reagenzienlieferant aufgeführt werden? (Bezahlter Service) | Klicken Sie hier, um Kontakt aufzunehmen ChemWhat |
Zugelassene Hersteller | |
| Warshel Chemical Ltd | https://www.warshel.com/ |
| Möchten Sie als zugelassener Hersteller gelistet werden (Genehmigung erforderlich)? | Bitte herunterladen und ausfüllen dieses Formular und zurück senden an zugelassene-hersteller@chemwhat.com |
Kontaktieren Sie uns für weitere Hilfe | |
| Kontaktieren Sie uns für weitere Informationen oder Dienstleistungen | Klicken Sie hier, um Kontakt aufzunehmen ChemWhat |